About 2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid
2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid (PubChem CID 68594962) has the molecular formula C20H30Cl2N2O4S
and a molecular weight of 465.44 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid.
Molecular Properties
| Compound Name | 2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid |
| PubChem CID | 68594962 |
| Molecular Formula | C20H30Cl2N2O4S |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid |
| SMILES | CCN(C1CCN(CCC(CC)(C(=O)O)c2ccc(Cl)c(Cl)c2)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C20H30Cl2N2O4S/c1-4-20(19(25)26,15-6-7-17(21)18(22)14-15)10-13-23-11-8-16(9-12-23)24(5-2)29(3,27)28/h6-7,14,16H,4-5,8-13H2,1-3H3,(H,25,26) |
| InChIKey | RGFRJYKPVAQTTA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid?
The IUPAC name of 2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid (CID 68594962) is 2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid.
What is the SMILES notation for 2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid?
The canonical SMILES for 2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid is CCN(C1CCN(CCC(CC)(C(=O)O)c2ccc(Cl)c(Cl)c2)CC1)S(C)(=O)=O.
What is the InChIKey of 2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid?
The InChIKey is RGFRJYKPVAQTTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30Cl2N2O4S/c1-4-20(19(25)26,15-6-7-17(21)18(22)14-15)10-13-23-11-8-16(9-12-23)24(5-2)29(3,27)28/h6-7,14,16H,4-5,8-13H2,1-3H3,(H,25,26).
What are the key properties of 2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid?
2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid has a molecular weight of 465.44 g/mol, XLogP of 3.86, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichlorophenyl)-2-ethyl-4-[4-[ethyl(methylsulfonyl)amino]piperidin-1-yl]butanoic acid is sourced from PubChem (CID 68594962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).