About 1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine
1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine (PubChem CID 6859497) has the molecular formula C16H14Cl2N6O2
and a molecular weight of 393.23 g/mol. Its IUPAC name is 1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine.
Molecular Properties
| Compound Name | 1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine |
| PubChem CID | 6859497 |
| Molecular Formula | C16H14Cl2N6O2 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine |
| SMILES | COc1cc(/C=N/n2nnnc2N)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl2N6O2/c1-25-15-6-10(8-20-24-16(19)21-22-23-24)2-5-14(15)26-9-11-3-4-12(17)7-13(11)18/h2-8H,9H2,1H3,(H2,19,21,23)/b20-8+ |
| InChIKey | MMNKRGOIZMAMBY-DNTJNYDQSA-N |
| XLogP | 3.03 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine?
The IUPAC name of 1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine (CID 6859497) is 1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine.
What is the SMILES notation for 1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine?
The canonical SMILES for 1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine is COc1cc(/C=N/n2nnnc2N)ccc1OCc1ccc(Cl)cc1Cl.
What is the InChIKey of 1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine?
The InChIKey is MMNKRGOIZMAMBY-DNTJNYDQSA-N. The full InChI is InChI=1S/C16H14Cl2N6O2/c1-25-15-6-10(8-20-24-16(19)21-22-23-24)2-5-14(15)26-9-11-3-4-12(17)7-13(11)18/h2-8H,9H2,1H3,(H2,19,21,23)/b20-8+.
What are the key properties of 1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine?
1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine has a molecular weight of 393.23 g/mol, XLogP of 3.03, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]tetrazol-5-amine is sourced from PubChem (CID 6859497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).