C7H11F3O6 — CID 68595246
(1S,2R,4S,5R)-6-(trifluoromethoxy)cyclohexane-1,2,3,4,5-pentol (PubChem CID 68595246) has the molecular formula C7H11F3O6 and a molecular weight of 248.15 g/mol. Its IUPAC name is (1S,2R,4S,5R)-6-(trifluoromethoxy)cyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1S,2R,4S,5R)-6-(trifluoromethoxy)cyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 68595246 |
| Molecular Formula | C7H11F3O6 |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (1S,2R,4S,5R)-6-(trifluoromethoxy)cyclohexane-1,2,3,4,5-pentol |
| SMILES | OC1[C@@H](O)[C@H](O)C(OC(F)(F)F)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H11F3O6/c8-7(9,10)16-6-4(14)2(12)1(11)3(13)5(6)15/h1-6,11-15H/t1?,2-,3+,4+,5-,6? |
| InChIKey | WUXBIDJUBCZUDO-UYSNGIAKSA-N |
| XLogP | -2.29 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |