About (4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine
(4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine (PubChem CID 68595565) has the molecular formula C15H22FNO
and a molecular weight of 251.34 g/mol. Its IUPAC name is (4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | (4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine |
| PubChem CID | 68595565 |
| Molecular Formula | C15H22FNO |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine |
| SMILES | CCCC1(CCC)C[C@@H](N)c2cccc(F)c2O1 |
| InChI | InChI=1S/C15H22FNO/c1-3-8-15(9-4-2)10-13(17)11-6-5-7-12(16)14(11)18-15/h5-7,13H,3-4,8-10,17H2,1-2H3/t13-/m1/s1 |
| InChIKey | QAMNDNRWQRWLGB-CYBMUJFWSA-N |
| XLogP | 3.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine?
The IUPAC name of (4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine (CID 68595565) is (4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine.
What is the SMILES notation for (4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine?
The canonical SMILES for (4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine is CCCC1(CCC)C[C@@H](N)c2cccc(F)c2O1.
What is the InChIKey of (4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine?
The InChIKey is QAMNDNRWQRWLGB-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H22FNO/c1-3-8-15(9-4-2)10-13(17)11-6-5-7-12(16)14(11)18-15/h5-7,13H,3-4,8-10,17H2,1-2H3/t13-/m1/s1.
What are the key properties of (4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine?
(4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine has a molecular weight of 251.34 g/mol, XLogP of 3.95, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-8-fluoro-2,2-dipropyl-3,4-dihydrochromen-4-amine is sourced from PubChem (CID 68595565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).