About 8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol
8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol (PubChem CID 68595983) has the molecular formula C11H11F3O2
and a molecular weight of 232.20 g/mol. Its IUPAC name is 8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | 8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol |
| PubChem CID | 68595983 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol |
| SMILES | OC1CC(CF)(CF)Oc2c(F)cccc21 |
| InChI | InChI=1S/C11H11F3O2/c12-5-11(6-13)4-9(15)7-2-1-3-8(14)10(7)16-11/h1-3,9,15H,4-6H2 |
| InChIKey | TVPBIYBFENROFN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol?
The IUPAC name of 8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol (CID 68595983) is 8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol.
What is the SMILES notation for 8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol?
The canonical SMILES for 8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol is OC1CC(CF)(CF)Oc2c(F)cccc21.
What is the InChIKey of 8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol?
The InChIKey is TVPBIYBFENROFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3O2/c12-5-11(6-13)4-9(15)7-2-1-3-8(14)10(7)16-11/h1-3,9,15H,4-6H2.
What are the key properties of 8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol?
8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol has a molecular weight of 232.20 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-2,2-bis(fluoromethyl)-3,4-dihydrochromen-4-ol is sourced from PubChem (CID 68595983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).