C11H13BrF3NO — CID 68595999
3-[2-bromo-5-(trifluoromethyl)phenoxy]-N-methylpropan-1-amine (PubChem CID 68595999) has the molecular formula C11H13BrF3NO and a molecular weight of 312.13 g/mol. Its IUPAC name is 3-[2-bromo-5-(trifluoromethyl)phenoxy]-N-methylpropan-1-amine.
| Compound Name | 3-[2-bromo-5-(trifluoromethyl)phenoxy]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 68595999 |
| Molecular Formula | C11H13BrF3NO |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 3-[2-bromo-5-(trifluoromethyl)phenoxy]-N-methylpropan-1-amine |
| SMILES | CNCCCOc1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C11H13BrF3NO/c1-16-5-2-6-17-10-7-8(11(13,14)15)3-4-9(10)12/h3-4,7,16H,2,5-6H2,1H3 |
| InChIKey | MCKIBRFQFGFLDQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|