About ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane
ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane (PubChem CID 68596329) has the molecular formula C22H38O2
and a molecular weight of 334.54 g/mol. Its IUPAC name is ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane.
Molecular Properties
| Compound Name | ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane |
| PubChem CID | 68596329 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane |
| SMILES | C=COC1CCCCC1.CC(C)CC=COC=CC1CCCCC1 |
| InChI | InChI=1S/C14H24O.C8H14O/c1-13(2)7-6-11-15-12-10-14-8-4-3-5-9-14;1-2-9-8-6-4-3-5-7-8/h6,10-14H,3-5,7-9H2,1-2H3;2,8H,1,3-7H2 |
| InChIKey | DAJONJCASNTPSI-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane?
The IUPAC name of ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane (CID 68596329) is ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane.
What is the SMILES notation for ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane?
The canonical SMILES for ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane is C=COC1CCCCC1.CC(C)CC=COC=CC1CCCCC1.
What is the InChIKey of ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane?
The InChIKey is DAJONJCASNTPSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O.C8H14O/c1-13(2)7-6-11-15-12-10-14-8-4-3-5-9-14;1-2-9-8-6-4-3-5-7-8/h6,10-14H,3-5,7-9H2,1-2H3;2,8H,1,3-7H2.
What are the key properties of ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane?
ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane has a molecular weight of 334.54 g/mol, XLogP of 7.14, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxycyclohexane;2-(4-methylpent-1-enoxy)ethenylcyclohexane is sourced from PubChem (CID 68596329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).