About 4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione
4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione (PubChem CID 685972) has the molecular formula C9H9BrN2S
and a molecular weight of 257.16 g/mol. Its IUPAC name is 4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione.
Molecular Properties
| Compound Name | 4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione |
| PubChem CID | 685972 |
| Molecular Formula | C9H9BrN2S |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione |
| SMILES | Cc1cc2[nH]c(=S)[nH]c2c(Br)c1C |
| InChI | InChI=1S/C9H9BrN2S/c1-4-3-6-8(7(10)5(4)2)12-9(13)11-6/h3H,1-2H3,(H2,11,12,13) |
| InChIKey | QMKQEBRZTFNBSQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione?
The IUPAC name of 4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione (CID 685972) is 4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione.
What is the SMILES notation for 4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione?
The canonical SMILES for 4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione is Cc1cc2[nH]c(=S)[nH]c2c(Br)c1C.
What is the InChIKey of 4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione?
The InChIKey is QMKQEBRZTFNBSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2S/c1-4-3-6-8(7(10)5(4)2)12-9(13)11-6/h3H,1-2H3,(H2,11,12,13).
What are the key properties of 4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione?
4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione has a molecular weight of 257.16 g/mol, XLogP of 3.60, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione is sourced from PubChem (CID 685972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).