About 2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine
2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine (PubChem CID 68597302) has the molecular formula C13H18FNO
and a molecular weight of 223.29 g/mol. Its IUPAC name is 2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | 2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine |
| PubChem CID | 68597302 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine |
| SMILES | CCC1(CC)CC(N)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C13H18FNO/c1-3-13(4-2)8-11(15)10-7-9(14)5-6-12(10)16-13/h5-7,11H,3-4,8,15H2,1-2H3 |
| InChIKey | XYDAYGQBVCPLNZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine?
The IUPAC name of 2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine (CID 68597302) is 2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine.
What is the SMILES notation for 2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine?
The canonical SMILES for 2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine is CCC1(CC)CC(N)c2cc(F)ccc2O1.
What is the InChIKey of 2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine?
The InChIKey is XYDAYGQBVCPLNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO/c1-3-13(4-2)8-11(15)10-7-9(14)5-6-12(10)16-13/h5-7,11H,3-4,8,15H2,1-2H3.
What are the key properties of 2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine?
2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine has a molecular weight of 223.29 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-6-fluoro-3,4-dihydrochromen-4-amine is sourced from PubChem (CID 68597302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).