C23H25N3O5 — CID 6859747
(5Z)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-1-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 6859747) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is (5Z)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-1-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-1-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6859747 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (5Z)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-1-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCN(CC)c1ccc(/C=C2/C(=O)NC(=O)N(Cc3ccc(OC)cc3)C2=O)c(O)c1 |
| InChI | InChI=1S/C23H25N3O5/c1-4-25(5-2)17-9-8-16(20(27)13-17)12-19-21(28)24-23(30)26(22(19)29)14-15-6-10-18(31-3)11-7-15/h6-13,27H,4-5,14H2,1-3H3,(H,24,28,30)/b19-12- |
| InChIKey | ANUNXGDLQCGUGM-UNOMPAQXSA-N |
| XLogP | 2.91 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|