C21H27FN4O4 — CID 68597585
tert-butyl-[1-[(5-fluoro-3-hydroxy-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid (PubChem CID 68597585) has the molecular formula C21H27FN4O4 and a molecular weight of 418.47 g/mol. Its IUPAC name is tert-butyl-[1-[(5-fluoro-3-hydroxy-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid.
| Compound Name | tert-butyl-[1-[(5-fluoro-3-hydroxy-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 68597585 |
| Molecular Formula | C21H27FN4O4 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | tert-butyl-[1-[(5-fluoro-3-hydroxy-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CCN(CC2(O)Cn3c(=O)ccc4ncc(F)c2c43)CC1 |
| InChI | InChI=1S/C21H27FN4O4/c1-20(2,3)26(19(28)29)13-6-8-24(9-7-13)11-21(30)12-25-16(27)5-4-15-18(25)17(21)14(22)10-23-15/h4-5,10,13,30H,6-9,11-12H2,1-3H3,(H,28,29) |
| InChIKey | OBXBJZRZYHUSND-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |