C16H20N4O2 — CID 68598126
(3R)-3-[(4-aminocyclohexyl)methyl]-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione (PubChem CID 68598126) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (3R)-3-[(4-aminocyclohexyl)methyl]-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione.
| Compound Name | (3R)-3-[(4-aminocyclohexyl)methyl]-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione |
|---|---|
| PubChem CID | 68598126 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3R)-3-[(4-aminocyclohexyl)methyl]-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione |
| SMILES | NC1CCC(C[C@@H]2Cn3c(=O)ccc4ncc(=O)n2c43)CC1 |
| InChI | InChI=1S/C16H20N4O2/c17-11-3-1-10(2-4-11)7-12-9-19-14(21)6-5-13-16(19)20(12)15(22)8-18-13/h5-6,8,10-12H,1-4,7,9,17H2/t10?,11?,12-/m1/s1 |
| InChIKey | YFTJGZCUDNUDCF-HTAVTVPLSA-N |
| XLogP | 1.02 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |