C23H27N3O5 — CID 68598683
ethyl 4-[2-[2-(cyclobutylcarbamoyl)pyrrolidin-1-yl]-2-oxoethoxy]quinoline-2-carboxylate (PubChem CID 68598683) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is ethyl 4-[2-[2-(cyclobutylcarbamoyl)pyrrolidin-1-yl]-2-oxoethoxy]quinoline-2-carboxylate.
| Compound Name | ethyl 4-[2-[2-(cyclobutylcarbamoyl)pyrrolidin-1-yl]-2-oxoethoxy]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 68598683 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | ethyl 4-[2-[2-(cyclobutylcarbamoyl)pyrrolidin-1-yl]-2-oxoethoxy]quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1cc(OCC(=O)N2CCCC2C(=O)NC2CCC2)c2ccccc2n1 |
| InChI | InChI=1S/C23H27N3O5/c1-2-30-23(29)18-13-20(16-9-3-4-10-17(16)25-18)31-14-21(27)26-12-6-11-19(26)22(28)24-15-7-5-8-15/h3-4,9-10,13,15,19H,2,5-8,11-12,14H2,1H3,(H,24,28) |
| InChIKey | GMBKHAAPJMAGKU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |