About 3,3,3-trifluoropropyl piperazine-1-carboxylate
3,3,3-trifluoropropyl piperazine-1-carboxylate (PubChem CID 68598860) has the molecular formula C8H13F3N2O2
and a molecular weight of 226.20 g/mol. Its IUPAC name is 3,3,3-trifluoropropyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | 3,3,3-trifluoropropyl piperazine-1-carboxylate |
| PubChem CID | 68598860 |
| Molecular Formula | C8H13F3N2O2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3,3,3-trifluoropropyl piperazine-1-carboxylate |
| SMILES | O=C(OCCC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C8H13F3N2O2/c9-8(10,11)1-6-15-7(14)13-4-2-12-3-5-13/h12H,1-6H2 |
| InChIKey | ALWXJGZQSPRALC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3,3-trifluoropropyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3,3-trifluoropropyl piperazine-1-carboxylate?
The IUPAC name of 3,3,3-trifluoropropyl piperazine-1-carboxylate (CID 68598860) is 3,3,3-trifluoropropyl piperazine-1-carboxylate.
What is the SMILES notation for 3,3,3-trifluoropropyl piperazine-1-carboxylate?
The canonical SMILES for 3,3,3-trifluoropropyl piperazine-1-carboxylate is O=C(OCCC(F)(F)F)N1CCNCC1.
What is the InChIKey of 3,3,3-trifluoropropyl piperazine-1-carboxylate?
The InChIKey is ALWXJGZQSPRALC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2O2/c9-8(10,11)1-6-15-7(14)13-4-2-12-3-5-13/h12H,1-6H2.
What are the key properties of 3,3,3-trifluoropropyl piperazine-1-carboxylate?
3,3,3-trifluoropropyl piperazine-1-carboxylate has a molecular weight of 226.20 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,3-trifluoropropyl piperazine-1-carboxylate is sourced from PubChem (CID 68598860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).