About 5H-phenanthro[9,10-b]furan-3,4-dione
5H-phenanthro[9,10-b]furan-3,4-dione (PubChem CID 68600378) has the molecular formula C16H10O3
and a molecular weight of 250.25 g/mol. Its IUPAC name is 5H-phenanthro[9,10-b]furan-3,4-dione.
Molecular Properties
| Compound Name | 5H-phenanthro[9,10-b]furan-3,4-dione |
| PubChem CID | 68600378 |
| Molecular Formula | C16H10O3 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5H-phenanthro[9,10-b]furan-3,4-dione |
| SMILES | O=C1CC=Cc2c1c1c(c3ccccc23)OCC1=O |
| InChI | InChI=1S/C16H10O3/c17-12-7-3-6-10-9-4-1-2-5-11(9)16-15(14(10)12)13(18)8-19-16/h1-6H,7-8H2 |
| InChIKey | FTIPSANVZJVJPI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-phenanthro[9,10-b]furan-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-phenanthro[9,10-b]furan-3,4-dione?
The IUPAC name of 5H-phenanthro[9,10-b]furan-3,4-dione (CID 68600378) is 5H-phenanthro[9,10-b]furan-3,4-dione.
What is the SMILES notation for 5H-phenanthro[9,10-b]furan-3,4-dione?
The canonical SMILES for 5H-phenanthro[9,10-b]furan-3,4-dione is O=C1CC=Cc2c1c1c(c3ccccc23)OCC1=O.
What is the InChIKey of 5H-phenanthro[9,10-b]furan-3,4-dione?
The InChIKey is FTIPSANVZJVJPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O3/c17-12-7-3-6-10-9-4-1-2-5-11(9)16-15(14(10)12)13(18)8-19-16/h1-6H,7-8H2.
What are the key properties of 5H-phenanthro[9,10-b]furan-3,4-dione?
5H-phenanthro[9,10-b]furan-3,4-dione has a molecular weight of 250.25 g/mol, XLogP of 3.01, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-phenanthro[9,10-b]furan-3,4-dione is sourced from PubChem (CID 68600378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).