C29H34F3NO4S — CID 68600660
3-[[5-[1-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]oxyoctyl]thiophene-2-carbonyl]amino]propanoic acid (PubChem CID 68600660) has the molecular formula C29H34F3NO4S and a molecular weight of 549.66 g/mol. Its IUPAC name is 3-[[5-[1-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]oxyoctyl]thiophene-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[5-[1-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]oxyoctyl]thiophene-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 68600660 |
| Molecular Formula | C29H34F3NO4S |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 3-[[5-[1-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]oxyoctyl]thiophene-2-carbonyl]amino]propanoic acid |
| SMILES | CCCCCCCC(OC1(C(F)(F)F)C=CC(c2ccccc2)=CC1)c1ccc(C(=O)NCCC(=O)O)s1 |
| InChI | InChI=1S/C29H34F3NO4S/c1-2-3-4-5-9-12-23(24-13-14-25(38-24)27(36)33-20-17-26(34)35)37-28(29(30,31)32)18-15-22(16-19-28)21-10-7-6-8-11-21/h6-8,10-11,13-16,18,23H,2-5,9,12,17,19-20H2,1H3,(H,33,36)(H,34,35) |
| InChIKey | JTSUPIVIIZTUOE-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|