C11H13ClN2O2 — CID 68601109
2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl-(3-chlorofuran-2-yl)methanone (PubChem CID 68601109) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl-(3-chlorofuran-2-yl)methanone.
| Compound Name | 2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl-(3-chlorofuran-2-yl)methanone |
|---|---|
| PubChem CID | 68601109 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl-(3-chlorofuran-2-yl)methanone |
| SMILES | O=C(c1occc1Cl)N1CCC2NCCC21 |
| InChI | InChI=1S/C11H13ClN2O2/c12-7-3-6-16-10(7)11(15)14-5-2-8-9(14)1-4-13-8/h3,6,8-9,13H,1-2,4-5H2 |
| InChIKey | SMGUMGKKVAUIHN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |