About 7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine
7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine (PubChem CID 68601177) has the molecular formula C8H6BrFO2
and a molecular weight of 233.04 g/mol. Its IUPAC name is 7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine.
Molecular Properties
| Compound Name | 7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine |
| PubChem CID | 68601177 |
| Molecular Formula | C8H6BrFO2 |
| Molecular Weight | 233.04 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | 7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine |
| SMILES | Fc1cc(Br)cc2c1OCCO2 |
| InChI | InChI=1S/C8H6BrFO2/c9-5-3-6(10)8-7(4-5)11-1-2-12-8/h3-4H,1-2H2 |
| InChIKey | RVFFKSCEEAHWKX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.04 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine?
The IUPAC name of 7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine (CID 68601177) is 7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine.
What is the SMILES notation for 7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine?
The canonical SMILES for 7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine is Fc1cc(Br)cc2c1OCCO2.
What is the InChIKey of 7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine?
The InChIKey is RVFFKSCEEAHWKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrFO2/c9-5-3-6(10)8-7(4-5)11-1-2-12-8/h3-4H,1-2H2.
What are the key properties of 7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine?
7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine has a molecular weight of 233.04 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-fluoro-2,3-dihydro-1,4-benzodioxine is sourced from PubChem (CID 68601177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).