About 2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile
2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile (PubChem CID 68601418) has the molecular formula C23H23N3
and a molecular weight of 341.46 g/mol. Its IUPAC name is 2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile.
Molecular Properties
| Compound Name | 2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile |
| PubChem CID | 68601418 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile |
| SMILES | Cc1nccn1[C@H]1CC[C@@H](C(C#N)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C23H23N3/c1-18-25-14-15-26(18)22-13-12-21(16-22)23(17-24,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,14-15,21-22H,12-13,16H2,1H3/t21-,22+/m1/s1 |
| InChIKey | SQWMGCVIXCRZDI-YADHBBJMSA-N |
| XLogP | 5.04 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile?
The IUPAC name of 2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile (CID 68601418) is 2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile.
What is the SMILES notation for 2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile?
The canonical SMILES for 2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile is Cc1nccn1[C@H]1CC[C@@H](C(C#N)(c2ccccc2)c2ccccc2)C1.
What is the InChIKey of 2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile?
The InChIKey is SQWMGCVIXCRZDI-YADHBBJMSA-N. The full InChI is InChI=1S/C23H23N3/c1-18-25-14-15-26(18)22-13-12-21(16-22)23(17-24,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,14-15,21-22H,12-13,16H2,1H3/t21-,22+/m1/s1.
What are the key properties of 2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile?
2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile has a molecular weight of 341.46 g/mol, XLogP of 5.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,3S)-3-(2-methylimidazol-1-yl)cyclopentyl]-2,2-diphenylacetonitrile is sourced from PubChem (CID 68601418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).