About 2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile
2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile (PubChem CID 68601434) has the molecular formula C19H19NO
and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile.
Molecular Properties
| Compound Name | 2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile |
| PubChem CID | 68601434 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile |
| SMILES | N#CC(c1ccccc1)(c1ccccc1)[C@@H]1CC[C@H](O)C1 |
| InChI | InChI=1S/C19H19NO/c20-14-19(15-7-3-1-4-8-15,16-9-5-2-6-10-16)17-11-12-18(21)13-17/h1-10,17-18,21H,11-13H2/t17-,18+/m1/s1 |
| InChIKey | LSILODPYFOAADX-MSOLQXFVSA-N |
| XLogP | 3.66 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile?
The IUPAC name of 2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile (CID 68601434) is 2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile.
What is the SMILES notation for 2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile?
The canonical SMILES for 2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile is N#CC(c1ccccc1)(c1ccccc1)[C@@H]1CC[C@H](O)C1.
What is the InChIKey of 2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile?
The InChIKey is LSILODPYFOAADX-MSOLQXFVSA-N. The full InChI is InChI=1S/C19H19NO/c20-14-19(15-7-3-1-4-8-15,16-9-5-2-6-10-16)17-11-12-18(21)13-17/h1-10,17-18,21H,11-13H2/t17-,18+/m1/s1.
What are the key properties of 2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile?
2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile has a molecular weight of 277.37 g/mol, XLogP of 3.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,3S)-3-hydroxycyclopentyl]-2,2-diphenylacetonitrile is sourced from PubChem (CID 68601434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).