C11H15N3O3 — CID 68602043
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl-(3-methoxy-1,2-oxazol-5-yl)methanone (PubChem CID 68602043) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl-(3-methoxy-1,2-oxazol-5-yl)methanone.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl-(3-methoxy-1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 68602043 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl-(3-methoxy-1,2-oxazol-5-yl)methanone |
| SMILES | COc1cc(C(=O)N2CC3CCNC3C2)on1 |
| InChI | InChI=1S/C11H15N3O3/c1-16-10-4-9(17-13-10)11(15)14-5-7-2-3-12-8(7)6-14/h4,7-8,12H,2-3,5-6H2,1H3 |
| InChIKey | DTJSHVLMTQLEQG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |