C17H14N6S2 — CID 6860289
4-[(E)-(3-methylthiophen-2-yl)methylideneamino]-3-(3-phenyl-1H-pyrazol-5-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 6860289) has the molecular formula C17H14N6S2 and a molecular weight of 366.48 g/mol. Its IUPAC name is 4-[(E)-(3-methylthiophen-2-yl)methylideneamino]-3-(3-phenyl-1H-pyrazol-5-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(3-methylthiophen-2-yl)methylideneamino]-3-(3-phenyl-1H-pyrazol-5-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6860289 |
| Molecular Formula | C17H14N6S2 |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 4-[(E)-(3-methylthiophen-2-yl)methylideneamino]-3-(3-phenyl-1H-pyrazol-5-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccsc1/C=N/n1c(-c2cc(-c3ccccc3)n[nH]2)n[nH]c1=S |
| InChI | InChI=1S/C17H14N6S2/c1-11-7-8-25-15(11)10-18-23-16(21-22-17(23)24)14-9-13(19-20-14)12-5-3-2-4-6-12/h2-10H,1H3,(H,19,20)(H,22,24)/b18-10+ |
| InChIKey | JYXBPKCFOJNZEJ-VCHYOVAHSA-N |
| XLogP | 4.25 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|