C11H14BrN3O2 — CID 68602898
2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridin-1-yl-(3-bromo-1,2-oxazol-5-yl)methanone (PubChem CID 68602898) has the molecular formula C11H14BrN3O2 and a molecular weight of 300.16 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridin-1-yl-(3-bromo-1,2-oxazol-5-yl)methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridin-1-yl-(3-bromo-1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 68602898 |
| Molecular Formula | C11H14BrN3O2 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridin-1-yl-(3-bromo-1,2-oxazol-5-yl)methanone |
| SMILES | O=C(c1cc(Br)no1)N1CCC2CNCCC21 |
| InChI | InChI=1S/C11H14BrN3O2/c12-10-5-9(17-14-10)11(16)15-4-2-7-6-13-3-1-8(7)15/h5,7-8,13H,1-4,6H2 |
| InChIKey | MTJMOCMGEQZKHG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |