About 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate
2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate (PubChem CID 68602979) has the molecular formula C22H27BrClNO4Si
and a molecular weight of 512.90 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate |
| PubChem CID | 68602979 |
| Molecular Formula | C22H27BrClNO4Si |
| Molecular Weight | 512.90 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate |
| SMILES | COc1ccccc1N(C)C(=O)c1cc(Br)c(Cl)cc1CC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C22H27BrClNO4Si/c1-25(19-8-6-7-9-20(19)28-2)22(27)16-14-17(23)18(24)12-15(16)13-21(26)29-10-11-30(3,4)5/h6-9,12,14H,10-11,13H2,1-5H3 |
| InChIKey | YDMPXPJHCJAZGK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.90 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate?
The IUPAC name of 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate (CID 68602979) is 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate.
What is the SMILES notation for 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate?
The canonical SMILES for 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate is COc1ccccc1N(C)C(=O)c1cc(Br)c(Cl)cc1CC(=O)OCC[Si](C)(C)C.
What is the InChIKey of 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate?
The InChIKey is YDMPXPJHCJAZGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27BrClNO4Si/c1-25(19-8-6-7-9-20(19)28-2)22(27)16-14-17(23)18(24)12-15(16)13-21(26)29-10-11-30(3,4)5/h6-9,12,14H,10-11,13H2,1-5H3.
What are the key properties of 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate?
2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate has a molecular weight of 512.90 g/mol, XLogP of 5.81, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate is sourced from PubChem (CID 68602979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).