C22H27BrClNO4Si — CID 68602979
2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate (PubChem CID 68602979) has the molecular formula C22H27BrClNO4Si and a molecular weight of 512.90 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate.
| Compound Name | 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate |
|---|---|
| PubChem CID | 68602979 |
| Molecular Formula | C22H27BrClNO4Si |
| Molecular Weight | 512.90 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 2-trimethylsilylethyl 2-[4-bromo-5-chloro-2-[(2-methoxyphenyl)-methylcarbamoyl]phenyl]acetate |
| SMILES | COc1ccccc1N(C)C(=O)c1cc(Br)c(Cl)cc1CC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C22H27BrClNO4Si/c1-25(19-8-6-7-9-20(19)28-2)22(27)16-14-17(23)18(24)12-15(16)13-21(26)29-10-11-30(3,4)5/h6-9,12,14H,10-11,13H2,1-5H3 |
| InChIKey | YDMPXPJHCJAZGK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.90 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|