About 1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene
1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene (PubChem CID 68603464) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene.
Molecular Properties
| Compound Name | 1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene |
| PubChem CID | 68603464 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene |
| SMILES | C=CC1(c2ccc(OC)c(OC)c2OC)CCC1 |
| InChI | InChI=1S/C15H20O3/c1-5-15(9-6-10-15)11-7-8-12(16-2)14(18-4)13(11)17-3/h5,7-8H,1,6,9-10H2,2-4H3 |
| InChIKey | FJNBREDDSXOGCC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene?
The IUPAC name of 1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene (CID 68603464) is 1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene.
What is the SMILES notation for 1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene?
The canonical SMILES for 1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene is C=CC1(c2ccc(OC)c(OC)c2OC)CCC1.
What is the InChIKey of 1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene?
The InChIKey is FJNBREDDSXOGCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-5-15(9-6-10-15)11-7-8-12(16-2)14(18-4)13(11)17-3/h5,7-8H,1,6,9-10H2,2-4H3.
What are the key properties of 1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene?
1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene has a molecular weight of 248.32 g/mol, XLogP of 3.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethenylcyclobutyl)-2,3,4-trimethoxybenzene is sourced from PubChem (CID 68603464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).