C18H30N2O6 — CID 68604026
N-[[(3aS,4R,6R,6aR)-2,2-dimethyl-6-[(2-methylpropan-2-yl)oxymethyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]carbamoyl]-3-methoxyprop-2-enamide (PubChem CID 68604026) has the molecular formula C18H30N2O6 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[[(3aS,4R,6R,6aR)-2,2-dimethyl-6-[(2-methylpropan-2-yl)oxymethyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]carbamoyl]-3-methoxyprop-2-enamide.
| Compound Name | N-[[(3aS,4R,6R,6aR)-2,2-dimethyl-6-[(2-methylpropan-2-yl)oxymethyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]carbamoyl]-3-methoxyprop-2-enamide |
|---|---|
| PubChem CID | 68604026 |
| Molecular Formula | C18H30N2O6 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | N-[[(3aS,4R,6R,6aR)-2,2-dimethyl-6-[(2-methylpropan-2-yl)oxymethyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]carbamoyl]-3-methoxyprop-2-enamide |
| SMILES | COC=CC(=O)NC(=O)N[C@@H]1C[C@H](COC(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H30N2O6/c1-17(2,3)24-10-11-9-12(15-14(11)25-18(4,5)26-15)19-16(22)20-13(21)7-8-23-6/h7-8,11-12,14-15H,9-10H2,1-6H3,(H2,19,20,21,22)/t11-,12-,14-,15+/m1/s1 |
| InChIKey | ODMCIQPDJIYHKG-GBOPCIDUSA-N |
| XLogP | 1.70 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|