C23H22ClFN2O — CID 68604581
6-chloro-5-[4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]-1-fluorocyclohexa-2,4-diene-1-carboxamide (PubChem CID 68604581) has the molecular formula C23H22ClFN2O and a molecular weight of 396.89 g/mol. Its IUPAC name is 6-chloro-5-[4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]-1-fluorocyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 6-chloro-5-[4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]-1-fluorocyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 68604581 |
| Molecular Formula | C23H22ClFN2O |
| Molecular Weight | 396.89 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 6-chloro-5-[4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]-1-fluorocyclohexa-2,4-diene-1-carboxamide |
| SMILES | NC(=O)C1(F)C=CC=C(c2ccc(CNC3Cc4ccccc4C3)cc2)C1Cl |
| InChI | InChI=1S/C23H22ClFN2O/c24-21-20(6-3-11-23(21,25)22(26)28)16-9-7-15(8-10-16)14-27-19-12-17-4-1-2-5-18(17)13-19/h1-11,19,21,27H,12-14H2,(H2,26,28) |
| InChIKey | FNMBHXJJHYUIOB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.89 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|