About 5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide
5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide (PubChem CID 68604615) has the molecular formula C15H19N3O3
and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide.
Molecular Properties
| Compound Name | 5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide |
| PubChem CID | 68604615 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide |
| SMILES | Cc1ccc(-c2cc(C)n(C[C@@H](O)CO)n2)cc1C(N)=O |
| InChI | InChI=1S/C15H19N3O3/c1-9-3-4-11(6-13(9)15(16)21)14-5-10(2)18(17-14)7-12(20)8-19/h3-6,12,19-20H,7-8H2,1-2H3,(H2,16,21)/t12-/m1/s1 |
| InChIKey | UKPKSHCAUVRHTO-GFCCVEGCSA-N |
| XLogP | 0.62 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide?
The IUPAC name of 5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide (CID 68604615) is 5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide.
What is the SMILES notation for 5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide?
The canonical SMILES for 5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide is Cc1ccc(-c2cc(C)n(C[C@@H](O)CO)n2)cc1C(N)=O.
What is the InChIKey of 5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide?
The InChIKey is UKPKSHCAUVRHTO-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H19N3O3/c1-9-3-4-11(6-13(9)15(16)21)14-5-10(2)18(17-14)7-12(20)8-19/h3-6,12,19-20H,7-8H2,1-2H3,(H2,16,21)/t12-/m1/s1.
What are the key properties of 5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide?
5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide has a molecular weight of 289.34 g/mol, XLogP of 0.62, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[(2R)-2,3-dihydroxypropyl]-5-methylpyrazol-3-yl]-2-methylbenzamide is sourced from PubChem (CID 68604615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).