(6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid

C10H12N4O2 — CID 68605000

IUPAC(6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid
SMILESCCCc1ccc2nc(NC(=O)O)cn2n1
InChIInChI=1S/C10H12N4O2/c1-2-3-7-4-5-9-11-8(12-10(15)16)6-14(9)13-7/h4-6,12H,2-3H2,1H3,(H,15,16)
InChIKeyAKXGTWXTVCOSPH-UHFFFAOYSA-N
MW220.23 g/mol
LogP1.77
Rot. Bonds3

About (6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid

(6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid (PubChem CID 68605000) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is (6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid.

Molecular Properties

Compound Name(6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid
PubChem CID68605000
Molecular FormulaC10H12N4O2
Molecular Weight220.23 g/mol
Exact Mass220.10
IUPAC Name(6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid
SMILESCCCc1ccc2nc(NC(=O)O)cn2n1
InChIInChI=1S/C10H12N4O2/c1-2-3-7-4-5-9-11-8(12-10(15)16)6-14(9)13-7/h4-6,12H,2-3H2,1H3,(H,15,16)
InChIKeyAKXGTWXTVCOSPH-UHFFFAOYSA-N
XLogP1.77
TPSA79.52 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.23
LogP ≤ 51.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid?
The IUPAC name of (6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid (CID 68605000) is (6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid.
What is the SMILES notation for (6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid?
The canonical SMILES for (6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid is CCCc1ccc2nc(NC(=O)O)cn2n1.
What is the InChIKey of (6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid?
The InChIKey is AKXGTWXTVCOSPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O2/c1-2-3-7-4-5-9-11-8(12-10(15)16)6-14(9)13-7/h4-6,12H,2-3H2,1H3,(H,15,16).
What are the key properties of (6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid?
(6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid has a molecular weight of 220.23 g/mol, XLogP of 1.77, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-propylimidazo[1,2-b]pyridazin-2-yl)carbamic acid is sourced from PubChem (CID 68605000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).