About (E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid
(E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid (PubChem CID 68605325) has the molecular formula C17H13F2NO4
and a molecular weight of 333.29 g/mol. Its IUPAC name is (E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid |
| PubChem CID | 68605325 |
| Molecular Formula | C17H13F2NO4 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid |
| SMILES | O=C(N/C(=C/c1cc(F)cc(F)c1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C17H13F2NO4/c18-13-6-12(7-14(19)9-13)8-15(16(21)22)20-17(23)24-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,20,23)(H,21,22)/b15-8+ |
| InChIKey | PYKRPEXCLDIOFJ-OVCLIPMQSA-N |
| XLogP | 3.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid?
The IUPAC name of (E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid (CID 68605325) is (E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid?
The canonical SMILES for (E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid is O=C(N/C(=C/c1cc(F)cc(F)c1)C(=O)O)OCc1ccccc1.
What is the InChIKey of (E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid?
The InChIKey is PYKRPEXCLDIOFJ-OVCLIPMQSA-N. The full InChI is InChI=1S/C17H13F2NO4/c18-13-6-12(7-14(19)9-13)8-15(16(21)22)20-17(23)24-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,20,23)(H,21,22)/b15-8+.
What are the key properties of (E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid?
(E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid has a molecular weight of 333.29 g/mol, XLogP of 3.32, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3,5-difluorophenyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid is sourced from PubChem (CID 68605325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).