About (3-pentyl-1,3-thiazolidin-4-yl)methanamine
(3-pentyl-1,3-thiazolidin-4-yl)methanamine (PubChem CID 68605554) has the molecular formula C9H20N2S
and a molecular weight of 188.34 g/mol. Its IUPAC name is (3-pentyl-1,3-thiazolidin-4-yl)methanamine.
Molecular Properties
| Compound Name | (3-pentyl-1,3-thiazolidin-4-yl)methanamine |
| PubChem CID | 68605554 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (3-pentyl-1,3-thiazolidin-4-yl)methanamine |
| SMILES | CCCCCN1CSCC1CN |
| InChI | InChI=1S/C9H20N2S/c1-2-3-4-5-11-8-12-7-9(11)6-10/h9H,2-8,10H2,1H3 |
| InChIKey | SONZLUBYSURWLF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3-pentyl-1,3-thiazolidin-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-pentyl-1,3-thiazolidin-4-yl)methanamine?
The IUPAC name of (3-pentyl-1,3-thiazolidin-4-yl)methanamine (CID 68605554) is (3-pentyl-1,3-thiazolidin-4-yl)methanamine.
What is the SMILES notation for (3-pentyl-1,3-thiazolidin-4-yl)methanamine?
The canonical SMILES for (3-pentyl-1,3-thiazolidin-4-yl)methanamine is CCCCCN1CSCC1CN.
What is the InChIKey of (3-pentyl-1,3-thiazolidin-4-yl)methanamine?
The InChIKey is SONZLUBYSURWLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2S/c1-2-3-4-5-11-8-12-7-9(11)6-10/h9H,2-8,10H2,1H3.
What are the key properties of (3-pentyl-1,3-thiazolidin-4-yl)methanamine?
(3-pentyl-1,3-thiazolidin-4-yl)methanamine has a molecular weight of 188.34 g/mol, XLogP of 1.51, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-pentyl-1,3-thiazolidin-4-yl)methanamine is sourced from PubChem (CID 68605554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).