C14H17N3O2 — CID 68605698
11-methoxy-4-pentyl-7-oxa-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene (PubChem CID 68605698) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 11-methoxy-4-pentyl-7-oxa-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene.
| Compound Name | 11-methoxy-4-pentyl-7-oxa-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
|---|---|
| PubChem CID | 68605698 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 11-methoxy-4-pentyl-7-oxa-2,5,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
| SMILES | CCCCCc1cn2c(n1)oc1ncc(OC)cc12 |
| InChI | InChI=1S/C14H17N3O2/c1-3-4-5-6-10-9-17-12-7-11(18-2)8-15-13(12)19-14(17)16-10/h7-9H,3-6H2,1-2H3 |
| InChIKey | BAQJMZCHXXRKGT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|