About 2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid
2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid (PubChem CID 68606428) has the molecular formula C18H13ClN4O2
and a molecular weight of 352.78 g/mol. Its IUPAC name is 2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid |
| PubChem CID | 68606428 |
| Molecular Formula | C18H13ClN4O2 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid |
| SMILES | Cc1cc2c(ccc3nnnn32)c(-c2ccc(Cl)cc2)c1CC(=O)O |
| InChI | InChI=1S/C18H13ClN4O2/c1-10-8-15-13(6-7-16-20-21-22-23(15)16)18(14(10)9-17(24)25)11-2-4-12(19)5-3-11/h2-8H,9H2,1H3,(H,24,25) |
| InChIKey | BNDHRPCYCCVTAV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid?
The IUPAC name of 2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid (CID 68606428) is 2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid.
What is the SMILES notation for 2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid?
The canonical SMILES for 2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid is Cc1cc2c(ccc3nnnn32)c(-c2ccc(Cl)cc2)c1CC(=O)O.
What is the InChIKey of 2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid?
The InChIKey is BNDHRPCYCCVTAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClN4O2/c1-10-8-15-13(6-7-16-20-21-22-23(15)16)18(14(10)9-17(24)25)11-2-4-12(19)5-3-11/h2-8H,9H2,1H3,(H,24,25).
What are the key properties of 2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid?
2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid has a molecular weight of 352.78 g/mol, XLogP of 3.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinolin-7-yl]acetic acid is sourced from PubChem (CID 68606428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).