C24H28F3N7O — CID 68606756
3-[[6-[3-(dimethylamino)propylamino]-2-methyl-3-pyridinyl]amino]-12-(trifluoromethyl)-2,4,15-triazatricyclo[8.5.0.01,6]pentadeca-2,5,10,12,14-pentaen-8-one (PubChem CID 68606756) has the molecular formula C24H28F3N7O and a molecular weight of 487.53 g/mol. Its IUPAC name is 3-[[6-[3-(dimethylamino)propylamino]-2-methyl-3-pyridinyl]amino]-12-(trifluoromethyl)-2,4,15-triazatricyclo[8.5.0.01,6]pentadeca-2,5,10,12,14-pentaen-8-one.
| Compound Name | 3-[[6-[3-(dimethylamino)propylamino]-2-methyl-3-pyridinyl]amino]-12-(trifluoromethyl)-2,4,15-triazatricyclo[8.5.0.01,6]pentadeca-2,5,10,12,14-pentaen-8-one |
|---|---|
| PubChem CID | 68606756 |
| Molecular Formula | C24H28F3N7O |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 3-[[6-[3-(dimethylamino)propylamino]-2-methyl-3-pyridinyl]amino]-12-(trifluoromethyl)-2,4,15-triazatricyclo[8.5.0.01,6]pentadeca-2,5,10,12,14-pentaen-8-one |
| SMILES | Cc1nc(NCCCN(C)C)ccc1NC1=NC23N=CC=C(C(F)(F)F)C=C2CC(=O)CC3=CN1 |
| InChI | InChI=1S/C24H28F3N7O/c1-15-20(5-6-21(31-15)28-8-4-10-34(2)3)32-22-29-14-18-13-19(35)12-17-11-16(24(25,26)27)7-9-30-23(17,18)33-22/h5-7,9,11,14H,4,8,10,12-13H2,1-3H3,(H,28,31)(H2,29,32,33) |
| InChIKey | KXAXQBDEHGLPBG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|