About 3-amino-2-(1,3,5-triazin-2-yl)propanoic acid
3-amino-2-(1,3,5-triazin-2-yl)propanoic acid (PubChem CID 68606798) has the molecular formula C6H8N4O2
and a molecular weight of 168.16 g/mol. Its IUPAC name is 3-amino-2-(1,3,5-triazin-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-amino-2-(1,3,5-triazin-2-yl)propanoic acid |
| PubChem CID | 68606798 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 3-amino-2-(1,3,5-triazin-2-yl)propanoic acid |
| SMILES | NCC(C(=O)O)c1ncncn1 |
| InChI | InChI=1S/C6H8N4O2/c7-1-4(6(11)12)5-9-2-8-3-10-5/h2-4H,1,7H2,(H,11,12) |
| InChIKey | JEKCLCDGZQJREK-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-2-(1,3,5-triazin-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(1,3,5-triazin-2-yl)propanoic acid?
The IUPAC name of 3-amino-2-(1,3,5-triazin-2-yl)propanoic acid (CID 68606798) is 3-amino-2-(1,3,5-triazin-2-yl)propanoic acid.
What is the SMILES notation for 3-amino-2-(1,3,5-triazin-2-yl)propanoic acid?
The canonical SMILES for 3-amino-2-(1,3,5-triazin-2-yl)propanoic acid is NCC(C(=O)O)c1ncncn1.
What is the InChIKey of 3-amino-2-(1,3,5-triazin-2-yl)propanoic acid?
The InChIKey is JEKCLCDGZQJREK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O2/c7-1-4(6(11)12)5-9-2-8-3-10-5/h2-4H,1,7H2,(H,11,12).
What are the key properties of 3-amino-2-(1,3,5-triazin-2-yl)propanoic acid?
3-amino-2-(1,3,5-triazin-2-yl)propanoic acid has a molecular weight of 168.16 g/mol, XLogP of -1.00, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(1,3,5-triazin-2-yl)propanoic acid is sourced from PubChem (CID 68606798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).