C24H24N2O5S — CID 68606818
(2-aminophenyl)sulfanyl (2S)-3-(4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 68606818) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is (2-aminophenyl)sulfanyl (2S)-3-(4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | (2-aminophenyl)sulfanyl (2S)-3-(4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 68606818 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (2-aminophenyl)sulfanyl (2S)-3-(4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COc1ccc(C[C@H](NC(=O)OCc2ccccc2)C(=O)OSc2ccccc2N)cc1 |
| InChI | InChI=1S/C24H24N2O5S/c1-29-19-13-11-17(12-14-19)15-21(23(27)31-32-22-10-6-5-9-20(22)25)26-24(28)30-16-18-7-3-2-4-8-18/h2-14,21H,15-16,25H2,1H3,(H,26,28)/t21-/m0/s1 |
| InChIKey | MORRUIXWIQARMQ-NRFANRHFSA-N |
| XLogP | 4.37 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|