About 1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid
1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid (PubChem CID 68607386) has the molecular formula C21H23N3O5
and a molecular weight of 397.43 g/mol. Its IUPAC name is 1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid.
Molecular Properties
| Compound Name | 1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid |
| PubChem CID | 68607386 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid |
| SMILES | CCCCCC(NC(=O)O)c1cccc(CON2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C21H23N3O5/c1-2-3-4-11-18(23-21(27)28)17-12-7-8-14(22-17)13-29-24-19(25)15-9-5-6-10-16(15)20(24)26/h5-10,12,18,23H,2-4,11,13H2,1H3,(H,27,28) |
| InChIKey | LXWMMNHLSLZFEH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid?
The IUPAC name of 1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid (CID 68607386) is 1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid.
What is the SMILES notation for 1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid?
The canonical SMILES for 1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid is CCCCCC(NC(=O)O)c1cccc(CON2C(=O)c3ccccc3C2=O)n1.
What is the InChIKey of 1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid?
The InChIKey is LXWMMNHLSLZFEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O5/c1-2-3-4-11-18(23-21(27)28)17-12-7-8-14(22-17)13-29-24-19(25)15-9-5-6-10-16(15)20(24)26/h5-10,12,18,23H,2-4,11,13H2,1H3,(H,27,28).
What are the key properties of 1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid?
1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid has a molecular weight of 397.43 g/mol, XLogP of 3.70, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-pyridinyl]hexylcarbamic acid is sourced from PubChem (CID 68607386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).