About N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine
N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine (PubChem CID 686075) has the molecular formula C13H12N4S
and a molecular weight of 256.33 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine |
| PubChem CID | 686075 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine |
| SMILES | Cc1cc(C)nc(Nc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C13H12N4S/c1-8-7-9(2)15-12(14-8)17-13-16-10-5-3-4-6-11(10)18-13/h3-7H,1-2H3,(H,14,15,16,17) |
| InChIKey | PLHCEZLRRVUOQJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine?
The IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine (CID 686075) is N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine?
The canonical SMILES for N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine is Cc1cc(C)nc(Nc2nc3ccccc3s2)n1.
What is the InChIKey of N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine?
The InChIKey is PLHCEZLRRVUOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4S/c1-8-7-9(2)15-12(14-8)17-13-16-10-5-3-4-6-11(10)18-13/h3-7H,1-2H3,(H,14,15,16,17).
What are the key properties of N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine?
N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine has a molecular weight of 256.33 g/mol, XLogP of 3.45, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzothiazol-2-amine is sourced from PubChem (CID 686075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).