About 4-chloro-1,2-oxazole-3-carboxamide
4-chloro-1,2-oxazole-3-carboxamide (PubChem CID 68607607) has the molecular formula C4H3ClN2O2
and a molecular weight of 146.53 g/mol. Its IUPAC name is 4-chloro-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-1,2-oxazole-3-carboxamide |
| PubChem CID | 68607607 |
| Molecular Formula | C4H3ClN2O2 |
| Molecular Weight | 146.53 g/mol |
| Exact Mass | 145.99 |
| IUPAC Name | 4-chloro-1,2-oxazole-3-carboxamide |
| SMILES | NC(=O)c1nocc1Cl |
| InChI | InChI=1S/C4H3ClN2O2/c5-2-1-9-7-3(2)4(6)8/h1H,(H2,6,8) |
| InChIKey | FPSDEPNPZBYRTG-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.53 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,2-oxazole-3-carboxamide?
The IUPAC name of 4-chloro-1,2-oxazole-3-carboxamide (CID 68607607) is 4-chloro-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 4-chloro-1,2-oxazole-3-carboxamide?
The canonical SMILES for 4-chloro-1,2-oxazole-3-carboxamide is NC(=O)c1nocc1Cl.
What is the InChIKey of 4-chloro-1,2-oxazole-3-carboxamide?
The InChIKey is FPSDEPNPZBYRTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3ClN2O2/c5-2-1-9-7-3(2)4(6)8/h1H,(H2,6,8).
What are the key properties of 4-chloro-1,2-oxazole-3-carboxamide?
4-chloro-1,2-oxazole-3-carboxamide has a molecular weight of 146.53 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 68607607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).