About (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol
(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol (PubChem CID 68608123) has the molecular formula C15H18F2N2OS
and a molecular weight of 312.38 g/mol. Its IUPAC name is (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol.
Molecular Properties
| Compound Name | (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol |
| PubChem CID | 68608123 |
| Molecular Formula | C15H18F2N2OS |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol |
| SMILES | N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CNCc1cccs1 |
| InChI | InChI=1S/C15H18F2N2OS/c16-11-4-10(5-12(17)7-11)6-14(18)15(20)9-19-8-13-2-1-3-21-13/h1-5,7,14-15,19-20H,6,8-9,18H2/t14-,15+/m0/s1 |
| InChIKey | QEWGJNGZYPVLBD-LSDHHAIUSA-N |
| XLogP | 2.05 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol?
The IUPAC name of (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol (CID 68608123) is (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol.
What is the SMILES notation for (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol?
The canonical SMILES for (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol is N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CNCc1cccs1.
What is the InChIKey of (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol?
The InChIKey is QEWGJNGZYPVLBD-LSDHHAIUSA-N. The full InChI is InChI=1S/C15H18F2N2OS/c16-11-4-10(5-12(17)7-11)6-14(18)15(20)9-19-8-13-2-1-3-21-13/h1-5,7,14-15,19-20H,6,8-9,18H2/t14-,15+/m0/s1.
What are the key properties of (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol?
(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol has a molecular weight of 312.38 g/mol, XLogP of 2.05, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-(thiophen-2-ylmethylamino)butan-2-ol is sourced from PubChem (CID 68608123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).