C34H41F2N3O3 — CID 68608476
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 68608476) has the molecular formula C34H41F2N3O3 and a molecular weight of 577.72 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68608476 |
| Molecular Formula | C34H41F2N3O3 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CN[C@@H]2CCc3ccccc32)c1 |
| InChI | InChI=1S/C34H41F2N3O3/c1-4-12-39(13-5-2)34(42)26-15-22(3)14-25(19-26)33(41)38-31(18-23-16-27(35)20-28(36)17-23)32(40)21-37-30-11-10-24-8-6-7-9-29(24)30/h6-9,14-17,19-20,30-32,37,40H,4-5,10-13,18,21H2,1-3H3,(H,38,41)/t30-,31+,32-/m1/s1 |
| InChIKey | MWSOTKFZGWZSGE-YKILCQELSA-N |
| XLogP | 5.51 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |