C13H17BrO4 — CID 6860848
methyl (2Z)-2-[(1S,4S,7S)-7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]-2-hydroxyacetate (PubChem CID 6860848) has the molecular formula C13H17BrO4 and a molecular weight of 317.18 g/mol. Its IUPAC name is methyl (2Z)-2-[(1S,4S,7S)-7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]-2-hydroxyacetate.
| Compound Name | methyl (2Z)-2-[(1S,4S,7S)-7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]-2-hydroxyacetate |
|---|---|
| PubChem CID | 6860848 |
| Molecular Formula | C13H17BrO4 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | methyl (2Z)-2-[(1S,4S,7S)-7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]-2-hydroxyacetate |
| SMILES | COC(=O)/C(O)=C1/C(=O)[C@@]2(C)CC[C@@H]1[C@]2(C)CBr |
| InChI | InChI=1S/C13H17BrO4/c1-12-5-4-7(13(12,2)6-14)8(10(12)16)9(15)11(17)18-3/h7,15H,4-6H2,1-3H3/b9-8-/t7-,12+,13-/m0/s1 |
| InChIKey | VWPNDMWKMFEUNP-BGOAKLSSSA-N |
| XLogP | 2.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|