C34H40F2N4O5 — CID 68608977
2-[(2S,3R)-4-[(3-acetylphenyl)methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 68608977) has the molecular formula C34H40F2N4O5 and a molecular weight of 622.71 g/mol. Its IUPAC name is 2-[(2S,3R)-4-[(3-acetylphenyl)methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 2-[(2S,3R)-4-[(3-acetylphenyl)methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 68608977 |
| Molecular Formula | C34H40F2N4O5 |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | 2-[(2S,3R)-4-[(3-acetylphenyl)methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(C(N)=O)c1[C@H](Cc1cc(F)cc(F)c1)[C@@H](O)CNCc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C34H40F2N4O5/c1-4-9-40(10-5-2)34(45)29-16-24(32(37)43)15-28(33(38)44)31(29)27(14-22-12-25(35)17-26(36)13-22)30(42)19-39-18-21-7-6-8-23(11-21)20(3)41/h6-8,11-13,15-17,27,30,39,42H,4-5,9-10,14,18-19H2,1-3H3,(H2,37,43)(H2,38,44)/t27-,30+/m1/s1 |
| InChIKey | LOWQQWXKPOYKFN-OFSOJUDTSA-N |
| XLogP | 4.10 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |