C17H14ClN3OS — CID 68609167
3-(2-chlorophenyl)-N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)prop-2-enamide (PubChem CID 68609167) has the molecular formula C17H14ClN3OS and a molecular weight of 343.84 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 68609167 |
| Molecular Formula | C17H14ClN3OS |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 3-(2-chlorophenyl)-N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)prop-2-enamide |
| SMILES | N#Cc1c(NC(=O)C=Cc2ccccc2Cl)sc2c1CCNC2 |
| InChI | InChI=1S/C17H14ClN3OS/c18-14-4-2-1-3-11(14)5-6-16(22)21-17-13(9-19)12-7-8-20-10-15(12)23-17/h1-6,20H,7-8,10H2,(H,21,22) |
| InChIKey | RAWLXFMTGNRODJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|