C40H47FN4O6 — CID 68609861
1-N-[(2S,3R)-1-(3-fluoro-5-phenylmethoxyphenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 68609861) has the molecular formula C40H47FN4O6 and a molecular weight of 698.84 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3-fluoro-5-phenylmethoxyphenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3-fluoro-5-phenylmethoxyphenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 68609861 |
| Molecular Formula | C40H47FN4O6 |
| Molecular Weight | 698.84 g/mol |
| Exact Mass | 698.35 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3-fluoro-5-phenylmethoxyphenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(C(=O)N[C@@H](Cc2cc(F)cc(OCc3ccccc3)c2)[C@H](O)CNCc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C40H47FN4O6/c1-4-14-45(15-5-2)40(49)32-21-30(38(42)47)20-31(22-32)39(48)44-36(37(46)25-43-24-28-12-9-13-34(17-28)50-3)19-29-16-33(41)23-35(18-29)51-26-27-10-7-6-8-11-27/h6-13,16-18,20-23,36-37,43,46H,4-5,14-15,19,24-26H2,1-3H3,(H2,42,47)(H,44,48)/t36-,37+/m0/s1 |
| InChIKey | HVZWMQRIKKMXPK-PQQNNWGCSA-N |
| XLogP | 5.27 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.84 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |