C26H31N5O7 — CID 68610153
[(2R)-3-(4-amino-3-methyl-5-nitrophenyl)-1-methoxy-1-oxopropan-2-yl] 4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)piperidine-1-carboxylate (PubChem CID 68610153) has the molecular formula C26H31N5O7 and a molecular weight of 525.56 g/mol. Its IUPAC name is [(2R)-3-(4-amino-3-methyl-5-nitrophenyl)-1-methoxy-1-oxopropan-2-yl] 4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)piperidine-1-carboxylate.
| Compound Name | [(2R)-3-(4-amino-3-methyl-5-nitrophenyl)-1-methoxy-1-oxopropan-2-yl] 4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68610153 |
| Molecular Formula | C26H31N5O7 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | [(2R)-3-(4-amino-3-methyl-5-nitrophenyl)-1-methoxy-1-oxopropan-2-yl] 4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)piperidine-1-carboxylate |
| SMILES | COC(=O)[C@@H](Cc1cc(C)c(N)c([N+](=O)[O-])c1)OC(=O)N1CCC(N2CCc3ccccc3NC2=O)CC1 |
| InChI | InChI=1S/C26H31N5O7/c1-16-13-17(14-21(23(16)27)31(35)36)15-22(24(32)37-2)38-26(34)29-10-8-19(9-11-29)30-12-7-18-5-3-4-6-20(18)28-25(30)33/h3-6,13-14,19,22H,7-12,15,27H2,1-2H3,(H,28,33)/t22-/m1/s1 |
| InChIKey | LZWNPCDTXKUTPT-JOCHJYFZSA-N |
| XLogP | 3.26 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|