C14H19NO5 — CID 68610690
butyl N-(6-bicyclo[3.1.0]hexa-1(6),2,4-trienyl)carbamate;2-hydroxypropanoic acid (PubChem CID 68610690) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is butyl N-(6-bicyclo[3.1.0]hexa-1(6),2,4-trienyl)carbamate;2-hydroxypropanoic acid.
| Compound Name | butyl N-(6-bicyclo[3.1.0]hexa-1(6),2,4-trienyl)carbamate;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 68610690 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | butyl N-(6-bicyclo[3.1.0]hexa-1(6),2,4-trienyl)carbamate;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.CCCCOC(=O)Nc1c2cccc1-2 |
| InChI | InChI=1S/C11H13NO2.C3H6O3/c1-2-3-7-14-11(13)12-10-8-5-4-6-9(8)10;1-2(4)3(5)6/h4-6H,2-3,7H2,1H3,(H,12,13);2,4H,1H3,(H,5,6) |
| InChIKey | BTEAGLILHOKTBX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|