About [(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid
[(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid (PubChem CID 68610941) has the molecular formula C20H24N4O4
and a molecular weight of 384.44 g/mol. Its IUPAC name is [(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid.
Molecular Properties
| Compound Name | [(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid |
| PubChem CID | 68610941 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | [(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid |
| SMILES | CO[C@@H]1CN(CCn2c(=O)cc(C)c3ccc(C#N)cc32)CC[C@@H]1NC(=O)O |
| InChI | InChI=1S/C20H24N4O4/c1-13-9-19(25)24(17-10-14(11-21)3-4-15(13)17)8-7-23-6-5-16(22-20(26)27)18(12-23)28-2/h3-4,9-10,16,18,22H,5-8,12H2,1-2H3,(H,26,27)/t16-,18+/m0/s1 |
| InChIKey | URHTZYNSVSDPOP-FUHWJXTLSA-N |
| XLogP | 1.54 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid?
The IUPAC name of [(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid (CID 68610941) is [(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid.
What is the SMILES notation for [(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid?
The canonical SMILES for [(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid is CO[C@@H]1CN(CCn2c(=O)cc(C)c3ccc(C#N)cc32)CC[C@@H]1NC(=O)O.
What is the InChIKey of [(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid?
The InChIKey is URHTZYNSVSDPOP-FUHWJXTLSA-N. The full InChI is InChI=1S/C20H24N4O4/c1-13-9-19(25)24(17-10-14(11-21)3-4-15(13)17)8-7-23-6-5-16(22-20(26)27)18(12-23)28-2/h3-4,9-10,16,18,22H,5-8,12H2,1-2H3,(H,26,27)/t16-,18+/m0/s1.
What are the key properties of [(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid?
[(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid has a molecular weight of 384.44 g/mol, XLogP of 1.54, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-1-[2-(7-cyano-4-methyl-2-oxoquinolin-1-yl)ethyl]-3-methoxypiperidin-4-yl]carbamic acid is sourced from PubChem (CID 68610941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).