About methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride
methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride (PubChem CID 68611403) has the molecular formula C16H20ClN3O4
and a molecular weight of 353.81 g/mol. Its IUPAC name is methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride |
| PubChem CID | 68611403 |
| Molecular Formula | C16H20ClN3O4 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride |
| SMILES | COC(=O)CCc1cc(-c2cncc(OC[C@@H]3CCN3)c2)on1.Cl |
| InChI | InChI=1S/C16H19N3O4.ClH/c1-21-16(20)3-2-12-7-15(23-19-12)11-6-14(9-17-8-11)22-10-13-4-5-18-13;/h6-9,13,18H,2-5,10H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | ULPKFSCBUHQEDK-ZOWNYOTGSA-N |
| XLogP | 2.00 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride?
The IUPAC name of methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride (CID 68611403) is methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride.
What is the SMILES notation for methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride?
The canonical SMILES for methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride is COC(=O)CCc1cc(-c2cncc(OC[C@@H]3CCN3)c2)on1.Cl.
What is the InChIKey of methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride?
The InChIKey is ULPKFSCBUHQEDK-ZOWNYOTGSA-N. The full InChI is InChI=1S/C16H19N3O4.ClH/c1-21-16(20)3-2-12-7-15(23-19-12)11-6-14(9-17-8-11)22-10-13-4-5-18-13;/h6-9,13,18H,2-5,10H2,1H3;1H/t13-;/m0./s1.
What are the key properties of methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride?
methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride has a molecular weight of 353.81 g/mol, XLogP of 2.00, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[5-[5-[[(2S)-azetidin-2-yl]methoxy]-3-pyridinyl]-1,2-oxazol-3-yl]propanoate;hydrochloride is sourced from PubChem (CID 68611403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).