C22H25F3N2O3 — CID 68611706
3-[3-[5-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-3-pyridinyl]phenyl]propyl 2,2,2-trifluoroacetate (PubChem CID 68611706) has the molecular formula C22H25F3N2O3 and a molecular weight of 422.45 g/mol. Its IUPAC name is 3-[3-[5-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-3-pyridinyl]phenyl]propyl 2,2,2-trifluoroacetate.
| Compound Name | 3-[3-[5-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-3-pyridinyl]phenyl]propyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68611706 |
| Molecular Formula | C22H25F3N2O3 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 3-[3-[5-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-3-pyridinyl]phenyl]propyl 2,2,2-trifluoroacetate |
| SMILES | CN1CCC[C@H]1COc1cncc(-c2cccc(CCCOC(=O)C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H25F3N2O3/c1-27-9-3-8-19(27)15-30-20-12-18(13-26-14-20)17-7-2-5-16(11-17)6-4-10-29-21(28)22(23,24)25/h2,5,7,11-14,19H,3-4,6,8-10,15H2,1H3/t19-/m0/s1 |
| InChIKey | VBNSPPHPRIYQSZ-IBGZPJMESA-N |
| XLogP | 4.26 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|